C38H50N2O5 — CID 101079014
(4R,9R,17R,22R)-27,29-dimethoxy-9,17-diphenyl-3,13,23-trioxa-10,16-diazatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-triene (PubChem CID 101079014) has the molecular formula C38H50N2O5 and a molecular weight of 614.83 g/mol. Its IUPAC name is (4R,9R,17R,22R)-27,29-dimethoxy-9,17-diphenyl-3,13,23-trioxa-10,16-diazatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-triene.
| Compound Name | (4R,9R,17R,22R)-27,29-dimethoxy-9,17-diphenyl-3,13,23-trioxa-10,16-diazatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-triene |
|---|---|
| PubChem CID | 101079014 |
| Molecular Formula | C38H50N2O5 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | (4R,9R,17R,22R)-27,29-dimethoxy-9,17-diphenyl-3,13,23-trioxa-10,16-diazatetracyclo[23.3.1.04,9.017,22]nonacosa-1(28),25(29),26-triene |
| SMILES | COc1cc2c(OC)c(c1)CO[C@@H]1CCCC[C@]1(c1ccccc1)NCCOCCN[C@@]1(c3ccccc3)CCCC[C@H]1OC2 |
| InChI | InChI=1S/C38H50N2O5/c1-41-33-25-29-27-44-34-17-9-11-19-37(34,31-13-5-3-6-14-31)39-21-23-43-24-22-40-38(32-15-7-4-8-16-32)20-12-10-18-35(38)45-28-30(26-33)36(29)42-2/h3-8,13-16,25-26,34-35,39-40H,9-12,17-24,27-28H2,1-2H3/t34-,35-,37-,38-/m1/s1 |
| InChIKey | GHGGLDGSWJBURT-QEZSNJNGSA-N |
| XLogP | 6.62 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |