C15H12F4O — CID 10107919
1-methoxy-4-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene (PubChem CID 10107919) has the molecular formula C15H12F4O and a molecular weight of 284.25 g/mol. Its IUPAC name is 1-methoxy-4-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene.
| Compound Name | 1-methoxy-4-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 10107919 |
| Molecular Formula | C15H12F4O |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-methoxy-4-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene |
| SMILES | COc1ccc(C(F)(F)C(F)(F)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12F4O/c1-20-13-9-7-12(8-10-13)15(18,19)14(16,17)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | IFXSUYKSSSYNOW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|