C17H31NO — CID 101079391
(3S,6R,8R,10S,13R)-13-ethyl-2,2,6-trimethyl-9-oxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 101079391) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (3S,6R,8R,10S,13R)-13-ethyl-2,2,6-trimethyl-9-oxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13R)-13-ethyl-2,2,6-trimethyl-9-oxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 101079391 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3S,6R,8R,10S,13R)-13-ethyl-2,2,6-trimethyl-9-oxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | CC[C@@H]1CC[C@@H]2O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N2C1 |
| InChI | InChI=1S/C17H31NO/c1-5-13-7-9-16-18(11-13)17(3,4)14-8-6-12(2)10-15(14)19-16/h12-16H,5-11H2,1-4H3/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | UGZJVGCCFLONAZ-QCODTGAPSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |