C23H36O6 — CID 101079488
methyl (1R,2R,5R)-2-[(3aR,7aR)-7,7-dimethyl-1-oxo-4,5,6,7a-tetrahydro-3H-2-benzofuran-3a-yl]-5-(1-ethoxy-1-oxopropan-2-yl)cyclohexane-1-carboxylate (PubChem CID 101079488) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl (1R,2R,5R)-2-[(3aR,7aR)-7,7-dimethyl-1-oxo-4,5,6,7a-tetrahydro-3H-2-benzofuran-3a-yl]-5-(1-ethoxy-1-oxopropan-2-yl)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2R,5R)-2-[(3aR,7aR)-7,7-dimethyl-1-oxo-4,5,6,7a-tetrahydro-3H-2-benzofuran-3a-yl]-5-(1-ethoxy-1-oxopropan-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101079488 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl (1R,2R,5R)-2-[(3aR,7aR)-7,7-dimethyl-1-oxo-4,5,6,7a-tetrahydro-3H-2-benzofuran-3a-yl]-5-(1-ethoxy-1-oxopropan-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C(C)[C@@H]1CC[C@@H]([C@]23CCCC(C)(C)[C@H]2C(=O)OC3)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C23H36O6/c1-6-28-19(24)14(2)15-8-9-17(16(12-15)20(25)27-5)23-11-7-10-22(3,4)18(23)21(26)29-13-23/h14-18H,6-13H2,1-5H3/t14?,15-,16-,17-,18-,23-/m1/s1 |
| InChIKey | NEVBWZLRLOZYGB-MYTOTREMSA-N |
| XLogP | 3.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|