C15H19ClN4 — CID 101080049
4-chloro-N,N-diethyl-6-(2-phenylethyl)-1,3,5-triazin-2-amine (PubChem CID 101080049) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 4-chloro-N,N-diethyl-6-(2-phenylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-diethyl-6-(2-phenylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 101080049 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-chloro-N,N-diethyl-6-(2-phenylethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(Cl)nc(CCc2ccccc2)n1 |
| InChI | InChI=1S/C15H19ClN4/c1-3-20(4-2)15-18-13(17-14(16)19-15)11-10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | GVOBOHMYLVQBBH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |