C17H39N3 — CID 10108024
1-N-dodecylpentane-1,2,5-triamine (PubChem CID 10108024) has the molecular formula C17H39N3 and a molecular weight of 285.52 g/mol. Its IUPAC name is 1-N-dodecylpentane-1,2,5-triamine.
| Compound Name | 1-N-dodecylpentane-1,2,5-triamine |
|---|---|
| PubChem CID | 10108024 |
| Molecular Formula | C17H39N3 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.31 |
| IUPAC Name | 1-N-dodecylpentane-1,2,5-triamine |
| SMILES | CCCCCCCCCCCCNCC(N)CCCN |
| InChI | InChI=1S/C17H39N3/c1-2-3-4-5-6-7-8-9-10-11-15-20-16-17(19)13-12-14-18/h17,20H,2-16,18-19H2,1H3 |
| InChIKey | JMXMGHOAUTYHNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|