C22H54OSi6 — CID 101080432
[2-tert-butyl-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane (PubChem CID 101080432) has the molecular formula C22H54OSi6 and a molecular weight of 503.19 g/mol. Its IUPAC name is [2-tert-butyl-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane.
| Compound Name | [2-tert-butyl-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101080432 |
| Molecular Formula | C22H54OSi6 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [2-tert-butyl-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)C1([Si](C)(C)C)C([Si](C)(C)C)=C([Si](C)(C)C)[Si]1(O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H54OSi6/c1-21(2,3)22(26(10,11)12)19(24(4,5)6)20(25(7,8)9)29(22,28(16,17)18)23-27(13,14)15/h1-18H3 |
| InChIKey | WCSKVGVNEPUYNC-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|