C28H60OSi6 — CID 101080433
[2-(1-adamantyl)-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane (PubChem CID 101080433) has the molecular formula C28H60OSi6 and a molecular weight of 581.30 g/mol. Its IUPAC name is [2-(1-adamantyl)-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane.
| Compound Name | [2-(1-adamantyl)-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101080433 |
| Molecular Formula | C28H60OSi6 |
| Molecular Weight | 581.30 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | [2-(1-adamantyl)-1,2,3,4-tetrakis(trimethylsilyl)silet-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[Si]1([Si](C)(C)C)C([Si](C)(C)C)=C([Si](C)(C)C)C1(C12CC3CC(CC(C3)C1)C2)[Si](C)(C)C |
| InChI | InChI=1S/C28H60OSi6/c1-30(2,3)25-26(31(4,5)6)35(34(13,14)15,29-33(10,11)12)28(25,32(7,8)9)27-19-22-16-23(20-27)18-24(17-22)21-27/h22-24H,16-21H2,1-15H3 |
| InChIKey | BKCVVOVPODEAQL-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.30 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|