C20H26O6 — CID 101080466
3-[(1R,2S,3S,7S,8R,11R)-2-methoxycarbonyl-4-methyl-12-methylidene-5-oxo-6-oxatetracyclo[9.2.1.01,8.03,7]tetradecan-7-yl]propanoic acid (PubChem CID 101080466) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 3-[(1R,2S,3S,7S,8R,11R)-2-methoxycarbonyl-4-methyl-12-methylidene-5-oxo-6-oxatetracyclo[9.2.1.01,8.03,7]tetradecan-7-yl]propanoic acid.
| Compound Name | 3-[(1R,2S,3S,7S,8R,11R)-2-methoxycarbonyl-4-methyl-12-methylidene-5-oxo-6-oxatetracyclo[9.2.1.01,8.03,7]tetradecan-7-yl]propanoic acid |
|---|---|
| PubChem CID | 101080466 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[(1R,2S,3S,7S,8R,11R)-2-methoxycarbonyl-4-methyl-12-methylidene-5-oxo-6-oxatetracyclo[9.2.1.01,8.03,7]tetradecan-7-yl]propanoic acid |
| SMILES | C=C1C[C@]23C[C@H]1CC[C@H]2[C@@]1(CCC(=O)O)OC(=O)C(C)[C@H]1[C@@H]3C(=O)OC |
| InChI | InChI=1S/C20H26O6/c1-10-8-19-9-12(10)4-5-13(19)20(7-6-14(21)22)15(11(2)17(23)26-20)16(19)18(24)25-3/h11-13,15-16H,1,4-9H2,2-3H3,(H,21,22)/t11?,12-,13-,15+,16-,19+,20-/m1/s1 |
| InChIKey | FTTONYNWWHZYAP-RRPJTSHUSA-N |
| XLogP | 2.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|