C12H13NO5S2 — CID 101080751
(1S,4S,5R,7R,8R)-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octane-4,8-diol (PubChem CID 101080751) has the molecular formula C12H13NO5S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is (1S,4S,5R,7R,8R)-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octane-4,8-diol.
| Compound Name | (1S,4S,5R,7R,8R)-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octane-4,8-diol |
|---|---|
| PubChem CID | 101080751 |
| Molecular Formula | C12H13NO5S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | (1S,4S,5R,7R,8R)-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octane-4,8-diol |
| SMILES | O=[N+]([O-])c1ccc(S[C@H]2O[C@H]3[C@@H](O)[C@@H]2SC[C@H]3O)cc1 |
| InChI | InChI=1S/C12H13NO5S2/c14-8-5-19-11-9(15)10(8)18-12(11)20-7-3-1-6(2-4-7)13(16)17/h1-4,8-12,14-15H,5H2/t8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | PMASJMHQGMVEFX-PZWNZHSQSA-N |
| XLogP | 1.25 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|