C13H13Cl2NO3 — CID 101080999
(3aR,4S,6R,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazole-4,6-diol (PubChem CID 101080999) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is (3aR,4S,6R,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazole-4,6-diol.
| Compound Name | (3aR,4S,6R,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazole-4,6-diol |
|---|---|
| PubChem CID | 101080999 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (3aR,4S,6R,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazole-4,6-diol |
| SMILES | C[C@@]1(O)C[C@H](O)[C@H]2C(c3c(Cl)cccc3Cl)=NO[C@H]21 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-13(18)5-8(17)10-11(16-19-12(10)13)9-6(14)3-2-4-7(9)15/h2-4,8,10,12,17-18H,5H2,1H3/t8-,10-,12+,13+/m0/s1 |
| InChIKey | VBNZKVAYPUFHGK-LOHPEHISSA-N |
| XLogP | 2.23 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |