About 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione
6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione (PubChem CID 10108111) has the molecular formula C16H14FNOS
and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
Molecular Properties
| Compound Name | 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| PubChem CID | 10108111 |
| Molecular Formula | C16H14FNOS |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| SMILES | CC1(C)OC(=S)Nc2ccc(-c3ccccc3F)cc21 |
| InChI | InChI=1S/C16H14FNOS/c1-16(2)12-9-10(11-5-3-4-6-13(11)17)7-8-14(12)18-15(20)19-16/h3-9H,1-2H3,(H,18,20) |
| InChIKey | GQLJJGUGKUYGRM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The IUPAC name of 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione (CID 10108111) is 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
What is the SMILES notation for 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The canonical SMILES for 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione is CC1(C)OC(=S)Nc2ccc(-c3ccccc3F)cc21.
What is the InChIKey of 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
The InChIKey is GQLJJGUGKUYGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNOS/c1-16(2)12-9-10(11-5-3-4-6-13(11)17)7-8-14(12)18-15(20)19-16/h3-9H,1-2H3,(H,18,20).
What are the key properties of 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione?
6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione has a molecular weight of 287.36 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione is sourced from PubChem (CID 10108111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).