C15H19N3O2 — CID 101081344
(10R,13R)-13-(hydroxymethyl)-9,10-dimethyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one (PubChem CID 101081344) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (10R,13R)-13-(hydroxymethyl)-9,10-dimethyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one.
| Compound Name | (10R,13R)-13-(hydroxymethyl)-9,10-dimethyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
|---|---|
| PubChem CID | 101081344 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (10R,13R)-13-(hydroxymethyl)-9,10-dimethyl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
| SMILES | C[C@@H]1C(=O)N[C@@H](CO)Cc2c[nH]c3cccc(c23)N1C |
| InChI | InChI=1S/C15H19N3O2/c1-9-15(20)17-11(8-19)6-10-7-16-12-4-3-5-13(14(10)12)18(9)2/h3-5,7,9,11,16,19H,6,8H2,1-2H3,(H,17,20)/t9-,11-/m1/s1 |
| InChIKey | DMPYQGWADDMFCK-MWLCHTKSSA-N |
| XLogP | 1.03 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |