C26H42O2 — CID 101081670
2-[(2E,7Z)-6-tert-butyl-9,9-dimethoxy-3,7-dimethylnona-2,4,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 101081670) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-[(2E,7Z)-6-tert-butyl-9,9-dimethoxy-3,7-dimethylnona-2,4,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(2E,7Z)-6-tert-butyl-9,9-dimethoxy-3,7-dimethylnona-2,4,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 101081670 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2-[(2E,7Z)-6-tert-butyl-9,9-dimethoxy-3,7-dimethylnona-2,4,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | COC(/C=C(/C)C(=C=C/C(C)=C/CC1=C(C)CCCC1(C)C)C(C)(C)C)OC |
| InChI | InChI=1S/C26H42O2/c1-19(14-16-23-20(2)12-11-17-26(23,7)8)13-15-22(25(4,5)6)21(3)18-24(27-9)28-10/h13-14,18,24H,11-12,16-17H2,1-10H3/b19-14+,21-18- |
| InChIKey | FXVFIJAKOODMEQ-DLZXYOEASA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|