C13H22O3 — CID 101083205
ethyl (2S,5S)-5-tert-butyl-3,5-dimethyl-2H-furan-2-carboxylate (PubChem CID 101083205) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethyl (2S,5S)-5-tert-butyl-3,5-dimethyl-2H-furan-2-carboxylate.
| Compound Name | ethyl (2S,5S)-5-tert-butyl-3,5-dimethyl-2H-furan-2-carboxylate |
|---|---|
| PubChem CID | 101083205 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethyl (2S,5S)-5-tert-butyl-3,5-dimethyl-2H-furan-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@](C)(C(C)(C)C)C=C1C |
| InChI | InChI=1S/C13H22O3/c1-7-15-11(14)10-9(2)8-13(6,16-10)12(3,4)5/h8,10H,7H2,1-6H3/t10-,13-/m0/s1 |
| InChIKey | ARGQSQJKRPLWKP-GWCFXTLKSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|