About CID 101083637
CID 101083637 (PubChem CID 101083637) has the molecular formula C13H18NO2
and a molecular weight of 220.29 g/mol.
Molecular Properties
| Compound Name | CID 101083637 |
| PubChem CID | 101083637 |
| Molecular Formula | C13H18NO2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(c2ccc(O)cc2)N1[O] |
| InChI | InChI=1S/C13H18NO2/c1-12(2)8-9-13(3,14(12)16)10-4-6-11(15)7-5-10/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | QTOFVVFDAFHHBJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101083637 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101083637?
The IUPAC name of CID 101083637 (CID 101083637) is not available.
What is the SMILES notation for CID 101083637?
The canonical SMILES for CID 101083637 is CC1(C)CCC(C)(c2ccc(O)cc2)N1[O].
What is the InChIKey of CID 101083637?
The InChIKey is QTOFVVFDAFHHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18NO2/c1-12(2)8-9-13(3,14(12)16)10-4-6-11(15)7-5-10/h4-7,15H,8-9H2,1-3H3.
What are the key properties of CID 101083637?
CID 101083637 has a molecular weight of 220.29 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101083637 is sourced from PubChem (CID 101083637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).