C17H13Cl2NO — CID 101083792
2-benzyl-1,1-dichloro-1a,7b-dihydrocyclopropa[c]isoquinolin-3-one (PubChem CID 101083792) has the molecular formula C17H13Cl2NO and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-benzyl-1,1-dichloro-1a,7b-dihydrocyclopropa[c]isoquinolin-3-one.
| Compound Name | 2-benzyl-1,1-dichloro-1a,7b-dihydrocyclopropa[c]isoquinolin-3-one |
|---|---|
| PubChem CID | 101083792 |
| Molecular Formula | C17H13Cl2NO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-benzyl-1,1-dichloro-1a,7b-dihydrocyclopropa[c]isoquinolin-3-one |
| SMILES | O=C1c2ccccc2C2C(N1Cc1ccccc1)C2(Cl)Cl |
| InChI | InChI=1S/C17H13Cl2NO/c18-17(19)14-12-8-4-5-9-13(12)16(21)20(15(14)17)10-11-6-2-1-3-7-11/h1-9,14-15H,10H2 |
| InChIKey | LJLTVLJMLAXVRX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|