C19H20N2O — CID 101084013
2,2-dimethyl-1-(4-phenylquinazolin-2-yl)propan-1-ol (PubChem CID 101084013) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-phenylquinazolin-2-yl)propan-1-ol.
| Compound Name | 2,2-dimethyl-1-(4-phenylquinazolin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 101084013 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2,2-dimethyl-1-(4-phenylquinazolin-2-yl)propan-1-ol |
| SMILES | CC(C)(C)C(O)c1nc(-c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C19H20N2O/c1-19(2,3)17(22)18-20-15-12-8-7-11-14(15)16(21-18)13-9-5-4-6-10-13/h4-12,17,22H,1-3H3 |
| InChIKey | IDRPGYHQIJLNQO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |