C15H18FNO6 — CID 101084080
(4aR,6S,7R,7aS)-6-[(S)-fluoro(methoxy)methyl]-7-methyl-7-nitro-2-phenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxine (PubChem CID 101084080) has the molecular formula C15H18FNO6 and a molecular weight of 327.31 g/mol. Its IUPAC name is (4aR,6S,7R,7aS)-6-[(S)-fluoro(methoxy)methyl]-7-methyl-7-nitro-2-phenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,7aS)-6-[(S)-fluoro(methoxy)methyl]-7-methyl-7-nitro-2-phenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 101084080 |
| Molecular Formula | C15H18FNO6 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (4aR,6S,7R,7aS)-6-[(S)-fluoro(methoxy)methyl]-7-methyl-7-nitro-2-phenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H](F)[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C15H18FNO6/c1-15(17(18)19)11-10(22-12(15)13(16)20-2)8-21-14(23-11)9-6-4-3-5-7-9/h3-7,10-14H,8H2,1-2H3/t10-,11-,12-,13-,14?,15-/m1/s1 |
| InChIKey | OWXSLDHGDUSYCG-CVRPCMMBSA-N |
| XLogP | 1.85 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|