C13H13ClN4O2 — CID 10108415
5-amino-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 10108415) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 5-amino-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-amino-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10108415 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-amino-N-[(E)-1-(4-chlorophenyl)ethylideneamino]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1c(C)noc1N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-7(9-3-5-10(14)6-4-9)16-17-13(19)11-8(2)18-20-12(11)15/h3-6H,15H2,1-2H3,(H,17,19)/b16-7+ |
| InChIKey | AATZFHYSXDWTFR-FRKPEAEDSA-N |
| XLogP | 2.37 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|