C40H60N8O2S4 — CID 101084197
11,23-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazatricyclo[19.3.1.19,13]hexacosane-2,8,14,20-tetrathione (PubChem CID 101084197) has the molecular formula C40H60N8O2S4 and a molecular weight of 813.24 g/mol. Its IUPAC name is 11,23-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazatricyclo[19.3.1.19,13]hexacosane-2,8,14,20-tetrathione.
| Compound Name | 11,23-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazatricyclo[19.3.1.19,13]hexacosane-2,8,14,20-tetrathione |
|---|---|
| PubChem CID | 101084197 |
| Molecular Formula | C40H60N8O2S4 |
| Molecular Weight | 813.24 g/mol |
| Exact Mass | 812.37 |
| IUPAC Name | 11,23-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazatricyclo[19.3.1.19,13]hexacosane-2,8,14,20-tetrathione |
| SMILES | S=C1NCCCNC(=S)N2CC(CCCCOCc3ccccc3)CN(C2)C(=S)NCCCNC(=S)N2CC(CCCCOCc3ccccc3)CN1C2 |
| InChI | InChI=1S/C40H60N8O2S4/c51-37-41-19-11-21-43-39(53)47-27-36(18-8-10-24-50-30-34-15-5-2-6-16-34)28-48(32-47)40(54)44-22-12-20-42-38(52)46-26-35(25-45(37)31-46)17-7-9-23-49-29-33-13-3-1-4-14-33/h1-6,13-16,35-36H,7-12,17-32H2,(H,41,51)(H,42,52)(H,43,53)(H,44,54) |
| InChIKey | BBFPPASNRRCCDI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|