C38H60N8O2S4 — CID 101084204
5,17-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazacyclotetracosane-2,8,14,20-tetrathione (PubChem CID 101084204) has the molecular formula C38H60N8O2S4 and a molecular weight of 789.22 g/mol. Its IUPAC name is 5,17-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazacyclotetracosane-2,8,14,20-tetrathione.
| Compound Name | 5,17-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazacyclotetracosane-2,8,14,20-tetrathione |
|---|---|
| PubChem CID | 101084204 |
| Molecular Formula | C38H60N8O2S4 |
| Molecular Weight | 789.22 g/mol |
| Exact Mass | 788.37 |
| IUPAC Name | 5,17-bis(4-phenylmethoxybutyl)-1,3,7,9,13,15,19,21-octazacyclotetracosane-2,8,14,20-tetrathione |
| SMILES | S=C1NCCCNC(=S)NCC(CCCCOCc2ccccc2)CNC(=S)NCCCNC(=S)NCC(CCCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C38H60N8O2S4/c49-35-39-19-11-21-41-37(51)45-27-34(18-8-10-24-48-30-32-15-5-2-6-16-32)28-46-38(52)42-22-12-20-40-36(50)44-26-33(25-43-35)17-7-9-23-47-29-31-13-3-1-4-14-31/h1-6,13-16,33-34H,7-12,17-30H2,(H2,39,43,49)(H2,40,44,50)(H2,41,45,51)(H2,42,46,52) |
| InChIKey | GKGRKLQIGUUZBE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|