C17H24O4 — CID 101084227
[(E)-3-[(2S,3aS,7aS)-3a-ethyl-6-prop-1-en-2-yl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran-2-yl]prop-2-enyl] acetate (PubChem CID 101084227) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(E)-3-[(2S,3aS,7aS)-3a-ethyl-6-prop-1-en-2-yl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran-2-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-[(2S,3aS,7aS)-3a-ethyl-6-prop-1-en-2-yl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 101084227 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(E)-3-[(2S,3aS,7aS)-3a-ethyl-6-prop-1-en-2-yl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran-2-yl]prop-2-enyl] acetate |
| SMILES | C=C(C)C1=C[C@@H]2O[C@H](/C=C/COC(C)=O)C[C@]2(CC)OC1 |
| InChI | InChI=1S/C17H24O4/c1-5-17-10-15(7-6-8-19-13(4)18)21-16(17)9-14(11-20-17)12(2)3/h6-7,9,15-16H,2,5,8,10-11H2,1,3-4H3/b7-6+/t15-,16+,17+/m1/s1 |
| InChIKey | QHSHRGAPMNYBQO-DIJBOSQOSA-N |
| XLogP | 2.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|