C7H13O2PS3 — CID 101084344
(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) ethanedithioate (PubChem CID 101084344) has the molecular formula C7H13O2PS3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) ethanedithioate.
| Compound Name | (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) ethanedithioate |
|---|---|
| PubChem CID | 101084344 |
| Molecular Formula | C7H13O2PS3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) ethanedithioate |
| SMILES | CC(=S)SP1(=S)OCC(C)(C)CO1 |
| InChI | InChI=1S/C7H13O2PS3/c1-6(11)13-10(12)8-4-7(2,3)5-9-10/h4-5H2,1-3H3 |
| InChIKey | ZKSYHILKFQFVDZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|