C17H26O6 — CID 101084514
1-[(4S,5S)-5-[(1R,2Z)-1-hydroxy-3-(methoxymethoxymethyl)-2-methylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-one (PubChem CID 101084514) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[(1R,2Z)-1-hydroxy-3-(methoxymethoxymethyl)-2-methylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S,5S)-5-[(1R,2Z)-1-hydroxy-3-(methoxymethoxymethyl)-2-methylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 101084514 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(4S,5S)-5-[(1R,2Z)-1-hydroxy-3-(methoxymethoxymethyl)-2-methylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)/C(C)=C(/C=C)COCOC |
| InChI | InChI=1S/C17H26O6/c1-7-12(9-21-10-20-6)11(3)14(19)16-15(13(18)8-2)22-17(4,5)23-16/h7-8,14-16,19H,1-2,9-10H2,3-6H3/b12-11-/t14-,15-,16+/m1/s1 |
| InChIKey | MCUCMBZSSMARDW-BTUISNHYSA-N |
| XLogP | 1.75 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|