C12H24BrNO2 — CID 10108475
1-(3-bromo-2-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 10108475) has the molecular formula C12H24BrNO2 and a molecular weight of 294.23 g/mol. Its IUPAC name is 1-(3-bromo-2-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-(3-bromo-2-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 10108475 |
| Molecular Formula | C12H24BrNO2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(3-bromo-2-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1CC(O)CBr |
| InChI | InChI=1S/C12H24BrNO2/c1-11(2)5-9(15)6-12(3,4)14(11)8-10(16)7-13/h9-10,15-16H,5-8H2,1-4H3 |
| InChIKey | HCUGEYCQVPHNMX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|