C26H30O3S2 — CID 101085141
S-tert-butyl (3S)-3-hydroxy-3-[1-(2,4,6-trimethylphenyl)sulfinylnaphthalen-2-yl]propanethioate (PubChem CID 101085141) has the molecular formula C26H30O3S2 and a molecular weight of 454.66 g/mol. Its IUPAC name is S-tert-butyl (3S)-3-hydroxy-3-[1-(2,4,6-trimethylphenyl)sulfinylnaphthalen-2-yl]propanethioate.
| Compound Name | S-tert-butyl (3S)-3-hydroxy-3-[1-(2,4,6-trimethylphenyl)sulfinylnaphthalen-2-yl]propanethioate |
|---|---|
| PubChem CID | 101085141 |
| Molecular Formula | C26H30O3S2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | S-tert-butyl (3S)-3-hydroxy-3-[1-(2,4,6-trimethylphenyl)sulfinylnaphthalen-2-yl]propanethioate |
| SMILES | Cc1cc(C)c(S(=O)c2c([C@@H](O)CC(=O)SC(C)(C)C)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H30O3S2/c1-16-13-17(2)24(18(3)14-16)31(29)25-20-10-8-7-9-19(20)11-12-21(25)22(27)15-23(28)30-26(4,5)6/h7-14,22,27H,15H2,1-6H3/t22-,31?/m0/s1 |
| InChIKey | YCSBRMASIXEUSK-DEUJGTPJSA-N |
| XLogP | 6.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|