C14H20O5 — CID 101085251
4-(5,5-dimethyl-1,3-dioxan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 101085251) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3-dioxan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 101085251 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=C(C2OCC(C)(C)CO2)C=CC1=O |
| InChI | InChI=1S/C14H20O5/c1-13(2)8-18-12(19-9-13)10-5-6-11(15)14(7-10,16-3)17-4/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | KWIJVYUKVPITPZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|