C29H29ClN4O6 — CID 101085312
[(2R,3S,5R)-5-[8-(2-chloroethyl)-3-methyl-5-oxo-[1,2,4]triazolo[4,3-c]pyrimidin-6-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 101085312) has the molecular formula C29H29ClN4O6 and a molecular weight of 565.03 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[8-(2-chloroethyl)-3-methyl-5-oxo-[1,2,4]triazolo[4,3-c]pyrimidin-6-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-5-[8-(2-chloroethyl)-3-methyl-5-oxo-[1,2,4]triazolo[4,3-c]pyrimidin-6-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 101085312 |
| Molecular Formula | C29H29ClN4O6 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [(2R,3S,5R)-5-[8-(2-chloroethyl)-3-methyl-5-oxo-[1,2,4]triazolo[4,3-c]pyrimidin-6-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](n3cc(CCCl)c4nnc(C)n4c3=O)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H29ClN4O6/c1-17-4-8-20(9-5-17)27(35)38-16-24-23(40-28(36)21-10-6-18(2)7-11-21)14-25(39-24)33-15-22(12-13-30)26-32-31-19(3)34(26)29(33)37/h4-11,15,23-25H,12-14,16H2,1-3H3/t23-,24+,25+/m0/s1 |
| InChIKey | OOKBIUPBKXYRQB-ISJGIBHGSA-N |
| XLogP | 3.97 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|