C15H21N3O2 — CID 101085422
(2R,3S)-3-amino-4-(3-methoxyphenyl)-2-morpholin-4-ylbutanenitrile (PubChem CID 101085422) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3-methoxyphenyl)-2-morpholin-4-ylbutanenitrile.
| Compound Name | (2R,3S)-3-amino-4-(3-methoxyphenyl)-2-morpholin-4-ylbutanenitrile |
|---|---|
| PubChem CID | 101085422 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (2R,3S)-3-amino-4-(3-methoxyphenyl)-2-morpholin-4-ylbutanenitrile |
| SMILES | COc1cccc(C[C@H](N)[C@H](C#N)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-19-13-4-2-3-12(9-13)10-14(17)15(11-16)18-5-7-20-8-6-18/h2-4,9,14-15H,5-8,10,17H2,1H3/t14-,15-/m0/s1 |
| InChIKey | NTLBTIWASGNCIP-GJZGRUSLSA-N |
| XLogP | 0.79 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |