C9H11NaO6S — CID 101085810
sodium (2-hydroxy-3-phenoxypropyl) sulfate (PubChem CID 101085810) has the molecular formula C9H11NaO6S and a molecular weight of 270.24 g/mol. Its IUPAC name is sodium (2-hydroxy-3-phenoxypropyl) sulfate.
| Compound Name | sodium (2-hydroxy-3-phenoxypropyl) sulfate |
|---|---|
| PubChem CID | 101085810 |
| Molecular Formula | C9H11NaO6S |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | sodium (2-hydroxy-3-phenoxypropyl) sulfate |
| SMILES | O=S(=O)([O-])OCC(O)COc1ccccc1.[Na+] |
| InChI | InChI=1S/C9H12O6S.Na/c10-8(7-15-16(11,12)13)6-14-9-4-2-1-3-5-9;/h1-5,8,10H,6-7H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | FFRATLAMSFPVHC-UHFFFAOYSA-M |
| XLogP | -3.09 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|