C10H10AlClO2 — CID 101086036
aluminum;(1R,2S)-1,2,3,4-tetrahydronaphthalene-1,2-diolate;chloride (PubChem CID 101086036) has the molecular formula C10H10AlClO2 and a molecular weight of 224.62 g/mol. Its IUPAC name is aluminum;(1R,2S)-1,2,3,4-tetrahydronaphthalene-1,2-diolate;chloride.
| Compound Name | aluminum;(1R,2S)-1,2,3,4-tetrahydronaphthalene-1,2-diolate;chloride |
|---|---|
| PubChem CID | 101086036 |
| Molecular Formula | C10H10AlClO2 |
| Molecular Weight | 224.62 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | aluminum;(1R,2S)-1,2,3,4-tetrahydronaphthalene-1,2-diolate;chloride |
| SMILES | [Al+3].[Cl-].[O-][C@@H]1c2ccccc2CC[C@@H]1[O-] |
| InChI | InChI=1S/C10H10O2.Al.ClH/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;;/h1-4,9-10H,5-6H2;;1H/q-2;+3;/p-1/t9-,10+;;/m0../s1 |
| InChIKey | SNZQCYIMFYJNFG-JXGSBULDSA-M |
| XLogP | -3.61 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.62 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |