About CID 101086187
CID 101086187 (PubChem CID 101086187) has the molecular formula C8H8NO3
and a molecular weight of 166.16 g/mol.
Molecular Properties
| Compound Name | CID 101086187 |
| PubChem CID | 101086187 |
| Molecular Formula | C8H8NO3 |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | — |
| SMILES | CC1(O)ON([O])c2ccccc21 |
| InChI | InChI=1S/C8H8NO3/c1-8(10)6-4-2-3-5-7(6)9(11)12-8/h2-5,10H,1H3 |
| InChIKey | QFXRRPMFSIKXSG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 101086187 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101086187?
The IUPAC name of CID 101086187 (CID 101086187) is not available.
What is the SMILES notation for CID 101086187?
The canonical SMILES for CID 101086187 is CC1(O)ON([O])c2ccccc21.
What is the InChIKey of CID 101086187?
The InChIKey is QFXRRPMFSIKXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NO3/c1-8(10)6-4-2-3-5-7(6)9(11)12-8/h2-5,10H,1H3.
What are the key properties of CID 101086187?
CID 101086187 has a molecular weight of 166.16 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101086187 is sourced from PubChem (CID 101086187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).