C25H26N2 — CID 101086223
(1R,8S,9R)-8-ethyl-10,10-dimethyl-5-(6-phenyl-2-pyridinyl)-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene (PubChem CID 101086223) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (1R,8S,9R)-8-ethyl-10,10-dimethyl-5-(6-phenyl-2-pyridinyl)-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1R,8S,9R)-8-ethyl-10,10-dimethyl-5-(6-phenyl-2-pyridinyl)-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 101086223 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (1R,8S,9R)-8-ethyl-10,10-dimethyl-5-(6-phenyl-2-pyridinyl)-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CC[C@@H]1c2nc(-c3cccc(-c4ccccc4)n3)ccc2[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C25H26N2/c1-4-17-19-15-20(25(19,2)3)18-13-14-23(27-24(17)18)22-12-8-11-21(26-22)16-9-6-5-7-10-16/h5-14,17,19-20H,4,15H2,1-3H3/t17-,19+,20-/m0/s1 |
| InChIKey | HHAGPRROTFPCNX-SXLOBPIMSA-N |
| XLogP | 6.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |