C27H33NO6 — CID 101086247
ethyl 8a-hydroxy-3,3-bis(4-methylphenyl)-6-propanoyl-4,5,7,8-tetrahydro-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate (PubChem CID 101086247) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is ethyl 8a-hydroxy-3,3-bis(4-methylphenyl)-6-propanoyl-4,5,7,8-tetrahydro-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate.
| Compound Name | ethyl 8a-hydroxy-3,3-bis(4-methylphenyl)-6-propanoyl-4,5,7,8-tetrahydro-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 101086247 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | ethyl 8a-hydroxy-3,3-bis(4-methylphenyl)-6-propanoyl-4,5,7,8-tetrahydro-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)C12CN(C(=O)CC)CCC1(O)OOC(c1ccc(C)cc1)(c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C27H33NO6/c1-5-23(29)28-16-15-27(31)25(18-28,24(30)32-6-2)17-26(33-34-27,21-11-7-19(3)8-12-21)22-13-9-20(4)10-14-22/h7-14,31H,5-6,15-18H2,1-4H3 |
| InChIKey | AVRJHYLEHLXHGU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|