C15H18 — CID 101086252
3-[(1S,2R)-2-methylcyclopentyl]prop-1-ynylbenzene (PubChem CID 101086252) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[(1S,2R)-2-methylcyclopentyl]prop-1-ynylbenzene.
| Compound Name | 3-[(1S,2R)-2-methylcyclopentyl]prop-1-ynylbenzene |
|---|---|
| PubChem CID | 101086252 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-[(1S,2R)-2-methylcyclopentyl]prop-1-ynylbenzene |
| SMILES | C[C@@H]1CCC[C@H]1CC#Cc1ccccc1 |
| InChI | InChI=1S/C15H18/c1-13-7-5-11-15(13)12-6-10-14-8-3-2-4-9-14/h2-4,8-9,13,15H,5,7,11-12H2,1H3/t13-,15+/m1/s1 |
| InChIKey | AGMYQGMFZLPTGY-HIFRSBDPSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|