About [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate
[2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 10108705) has the molecular formula C15H22O6
and a molecular weight of 298.34 g/mol. Its IUPAC name is [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
| PubChem CID | 10108705 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC1C=CC(=O)OC1CCC(O)C(C)O |
| InChI | InChI=1S/C15H22O6/c1-4-9(2)15(19)21-13-7-8-14(18)20-12(13)6-5-11(17)10(3)16/h4,7-8,10-13,16-17H,5-6H2,1-3H3/b9-4+ |
| InChIKey | ZFVYHTGRRBKBJE-RUDMXATFSA-N |
| XLogP | 0.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate?
The IUPAC name of [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate (CID 10108705) is [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate.
What is the SMILES notation for [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate?
The canonical SMILES for [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)OC1C=CC(=O)OC1CCC(O)C(C)O.
What is the InChIKey of [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate?
The InChIKey is ZFVYHTGRRBKBJE-RUDMXATFSA-N. The full InChI is InChI=1S/C15H22O6/c1-4-9(2)15(19)21-13-7-8-14(18)20-12(13)6-5-11(17)10(3)16/h4,7-8,10-13,16-17H,5-6H2,1-3H3/b9-4+.
What are the key properties of [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate?
[2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate has a molecular weight of 298.34 g/mol, XLogP of 0.87, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dihydroxypentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate is sourced from PubChem (CID 10108705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).