C16H18Cl3NO7 — CID 101087559
2,2,2-trichloroethyl N-[(2R,4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 101087559) has the molecular formula C16H18Cl3NO7 and a molecular weight of 442.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2R,4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2R,4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 101087559 |
| Molecular Formula | C16H18Cl3NO7 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2R,4aR,7R,8R,8aS)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | O=C(N[C@H]1C(O)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3NO7/c17-16(18,19)7-25-15(23)20-10-11(21)12-9(26-13(10)22)6-24-14(27-12)8-4-2-1-3-5-8/h1-5,9-14,21-22H,6-7H2,(H,20,23)/t9-,10-,11-,12-,13?,14-/m1/s1 |
| InChIKey | CQGHSMICOUMHFZ-ZZOOZXLSSA-N |
| XLogP | 1.64 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|