C11H16O8S3 — CID 101087874
[(4S,5S)-5-(methylsulfonyloxymethyl)-2-thiophen-3-yl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 101087874) has the molecular formula C11H16O8S3 and a molecular weight of 372.44 g/mol. Its IUPAC name is [(4S,5S)-5-(methylsulfonyloxymethyl)-2-thiophen-3-yl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4S,5S)-5-(methylsulfonyloxymethyl)-2-thiophen-3-yl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101087874 |
| Molecular Formula | C11H16O8S3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [(4S,5S)-5-(methylsulfonyloxymethyl)-2-thiophen-3-yl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1OC(c2ccsc2)O[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C11H16O8S3/c1-21(12,13)16-5-9-10(6-17-22(2,14)15)19-11(18-9)8-3-4-20-7-8/h3-4,7,9-11H,5-6H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | NUAXLUQNRDUDMI-UWVGGRQHSA-N |
| XLogP | 0.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|