C14H20O2 — CID 101088350
butyl (1R,6R,7S)-bicyclo[4.2.1]nona-2,4-diene-7-carboxylate (PubChem CID 101088350) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is butyl (1R,6R,7S)-bicyclo[4.2.1]nona-2,4-diene-7-carboxylate.
| Compound Name | butyl (1R,6R,7S)-bicyclo[4.2.1]nona-2,4-diene-7-carboxylate |
|---|---|
| PubChem CID | 101088350 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | butyl (1R,6R,7S)-bicyclo[4.2.1]nona-2,4-diene-7-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C[C@@H]2C=CC=C[C@H]1C2 |
| InChI | InChI=1S/C14H20O2/c1-2-3-8-16-14(15)13-10-11-6-4-5-7-12(13)9-11/h4-7,11-13H,2-3,8-10H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | JRHMVQXYLSEENB-AGIUHOORSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|