C11H14O5 — CID 101089466
(1S,5R,7R,9S,10R,11S)-9,10-dihydroxy-11-methyl-4-methylidene-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one (PubChem CID 101089466) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (1S,5R,7R,9S,10R,11S)-9,10-dihydroxy-11-methyl-4-methylidene-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one.
| Compound Name | (1S,5R,7R,9S,10R,11S)-9,10-dihydroxy-11-methyl-4-methylidene-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one |
|---|---|
| PubChem CID | 101089466 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1S,5R,7R,9S,10R,11S)-9,10-dihydroxy-11-methyl-4-methylidene-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one |
| SMILES | C=C1OC(=O)[C@@]23[C@H](C)[C@@H](C[C@H](O)[C@@H]2O)O[C@@H]13 |
| InChI | InChI=1S/C11H14O5/c1-4-7-3-6(12)8(13)11(4)9(16-7)5(2)15-10(11)14/h4,6-9,12-13H,2-3H2,1H3/t4-,6+,7-,8+,9+,11+/m1/s1 |
| InChIKey | WEYVNBPVWCXGFX-VEOPCPMWSA-N |
| XLogP | -0.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |