C25H30F3NO2 — CID 101089877
2,2,2-trifluoro-N-[(1R,2R)-1-[(4R,6S)-4-methyl-6-phenylhept-1-en-4-yl]oxy-1-phenylpropan-2-yl]acetamide (PubChem CID 101089877) has the molecular formula C25H30F3NO2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-1-[(4R,6S)-4-methyl-6-phenylhept-1-en-4-yl]oxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(4R,6S)-4-methyl-6-phenylhept-1-en-4-yl]oxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 101089877 |
| Molecular Formula | C25H30F3NO2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(4R,6S)-4-methyl-6-phenylhept-1-en-4-yl]oxy-1-phenylpropan-2-yl]acetamide |
| SMILES | C=CC[C@](C)(C[C@H](C)c1ccccc1)O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO2/c1-5-16-24(4,17-18(2)20-12-8-6-9-13-20)31-22(21-14-10-7-11-15-21)19(3)29-23(30)25(26,27)28/h5-15,18-19,22H,1,16-17H2,2-4H3,(H,29,30)/t18-,19+,22-,24+/m0/s1 |
| InChIKey | KTSLHSLWSYHVHS-SMKKKYSBSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|