C32H42O3Si2 — CID 101090282
tert-butyl-[(2S,3R)-2-ethynyl-4,4-dimethyl-2-[(3R)-5-trimethylsilylpent-1-en-4-yn-3-yl]oxyoxolan-3-yl]oxy-diphenylsilane (PubChem CID 101090282) has the molecular formula C32H42O3Si2 and a molecular weight of 530.86 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-2-ethynyl-4,4-dimethyl-2-[(3R)-5-trimethylsilylpent-1-en-4-yn-3-yl]oxyoxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3R)-2-ethynyl-4,4-dimethyl-2-[(3R)-5-trimethylsilylpent-1-en-4-yn-3-yl]oxyoxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 101090282 |
| Molecular Formula | C32H42O3Si2 |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | tert-butyl-[(2S,3R)-2-ethynyl-4,4-dimethyl-2-[(3R)-5-trimethylsilylpent-1-en-4-yn-3-yl]oxyoxolan-3-yl]oxy-diphenylsilane |
| SMILES | C#C[C@@]1(O[C@@H](C#C[Si](C)(C)C)C=C)OCC(C)(C)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H42O3Si2/c1-11-26(23-24-36(8,9)10)34-32(12-2)29(31(6,7)25-33-32)35-37(30(3,4)5,27-19-15-13-16-20-27)28-21-17-14-18-22-28/h2,11,13-22,26,29H,1,25H2,3-10H3/t26-,29-,32+/m1/s1 |
| InChIKey | PGJYDANDFDKIDP-LIUITUQLSA-N |
| XLogP | 5.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|