C38H50O12SSi — CID 101090345
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl]sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 101090345) has the molecular formula C38H50O12SSi and a molecular weight of 758.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl]sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101090345 |
| Molecular Formula | C38H50O12SSi |
| Molecular Weight | 758.96 g/mol |
| Exact Mass | 758.28 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CCO[C@@H]1C=C[C@H](S[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C38H50O12SSi/c1-9-43-33-21-20-32(30(49-33)23-45-52(38(6,7)8,28-16-12-10-13-17-28)29-18-14-11-15-19-29)51-37-36(48-27(5)42)35(47-26(4)41)34(46-25(3)40)31(50-37)22-44-24(2)39/h10-21,30-37H,9,22-23H2,1-8H3/t30-,31-,32+,33+,34-,35+,36-,37+/m1/s1 |
| InChIKey | WBSYRSSHNQZWJJ-RIORFIBFSA-N |
| XLogP | 4.07 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|