C19H26N4O3 — CID 10109052
(3R)-6-cyclohexyl-N-hydroxy-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hexanamide (PubChem CID 10109052) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-N-hydroxy-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hexanamide.
| Compound Name | (3R)-6-cyclohexyl-N-hydroxy-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 10109052 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3R)-6-cyclohexyl-N-hydroxy-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)hexanamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(-c2cccnc2)no1)NO |
| InChI | InChI=1S/C19H26N4O3/c24-17(22-25)12-15(9-4-8-14-6-2-1-3-7-14)19-21-18(23-26-19)16-10-5-11-20-13-16/h5,10-11,13-15,25H,1-4,6-9,12H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | SITLCQPORCSLQV-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|