About [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol
[(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol (PubChem CID 101090588) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 101090588 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)=CCC/C(C)=C/CN1CCC[C@H]1CO |
| InChI | InChI=1S/C15H27NO/c1-13(2)6-4-7-14(3)9-11-16-10-5-8-15(16)12-17/h6,9,15,17H,4-5,7-8,10-12H2,1-3H3/b14-9+/t15-/m0/s1 |
| InChIKey | BNOAXXLFVBNBAD-HNRFISLBSA-N |
| XLogP | 3.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol (CID 101090588) is [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol is CC(C)=CCC/C(C)=C/CN1CCC[C@H]1CO.
What is the InChIKey of [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol?
The InChIKey is BNOAXXLFVBNBAD-HNRFISLBSA-N. The full InChI is InChI=1S/C15H27NO/c1-13(2)6-4-7-14(3)9-11-16-10-5-8-15(16)12-17/h6,9,15,17H,4-5,7-8,10-12H2,1-3H3/b14-9+/t15-/m0/s1.
What are the key properties of [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol?
[(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol has a molecular weight of 237.39 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 101090588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).