C22H42O3Si — CID 101090691
(1R,4S,6S)-2,2,6-trimethyl-4-tributylsilyloxy-7-oxabicyclo[4.1.0]heptane-1-carbaldehyde (PubChem CID 101090691) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (1R,4S,6S)-2,2,6-trimethyl-4-tributylsilyloxy-7-oxabicyclo[4.1.0]heptane-1-carbaldehyde.
| Compound Name | (1R,4S,6S)-2,2,6-trimethyl-4-tributylsilyloxy-7-oxabicyclo[4.1.0]heptane-1-carbaldehyde |
|---|---|
| PubChem CID | 101090691 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (1R,4S,6S)-2,2,6-trimethyl-4-tributylsilyloxy-7-oxabicyclo[4.1.0]heptane-1-carbaldehyde |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@H]1CC(C)(C)[C@@]2(C=O)O[C@@]2(C)C1 |
| InChI | InChI=1S/C22H42O3Si/c1-7-10-13-26(14-11-8-2,15-12-9-3)24-19-16-20(4,5)22(18-23)21(6,17-19)25-22/h18-19H,7-17H2,1-6H3/t19-,21-,22+/m0/s1 |
| InChIKey | RJYDCEYDFFOJKA-ILWGZMRPSA-N |
| XLogP | 6.26 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|