C11H7F7LiNO5S2 — CID 101090951
lithium [2-(4-ethenylphenoxy)-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 101090951) has the molecular formula C11H7F7LiNO5S2 and a molecular weight of 437.24 g/mol. Its IUPAC name is lithium [2-(4-ethenylphenoxy)-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | lithium [2-(4-ethenylphenoxy)-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 101090951 |
| Molecular Formula | C11H7F7LiNO5S2 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | lithium [2-(4-ethenylphenoxy)-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | C=Cc1ccc(OC(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1.[Li+] |
| InChI | InChI=1S/C11H7F7NO5S2.Li/c1-2-7-3-5-8(6-4-7)24-9(12,13)10(14,15)25(20,21)19-26(22,23)11(16,17)18;/h2-6H,1H2;/q-1;+1 |
| InChIKey | CONNMCHVYKQLGM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|