C19H20ClF13OSi — CID 101091343
1-[tert-butyl(dimethyl)silyl]-1-(4-chlorophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol (PubChem CID 101091343) has the molecular formula C19H20ClF13OSi and a molecular weight of 574.88 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-1-(4-chlorophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-1-(4-chlorophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
|---|---|
| PubChem CID | 101091343 |
| Molecular Formula | C19H20ClF13OSi |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-1-(4-chlorophenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)C(O)(c1ccc(Cl)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H20ClF13OSi/c1-12(2,3)35(4,5)13(34,10-6-8-11(20)9-7-10)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)33/h6-9,34H,1-5H3 |
| InChIKey | HMLDIPBXIVBPAA-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|