About [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate
[3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate (PubChem CID 10109152) has the molecular formula C9H12O9S3
and a molecular weight of 360.39 g/mol. Its IUPAC name is [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate |
| PubChem CID | 10109152 |
| Molecular Formula | C9H12O9S3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(OS(C)(=O)=O)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H12O9S3/c1-19(10,11)16-7-4-5-8(17-20(2,12)13)9(6-7)18-21(3,14)15/h4-6H,1-3H3 |
| InChIKey | XKLHYWFVMNOSKU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate?
The IUPAC name of [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate (CID 10109152) is [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate.
What is the SMILES notation for [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate?
The canonical SMILES for [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate is CS(=O)(=O)Oc1ccc(OS(C)(=O)=O)c(OS(C)(=O)=O)c1.
What is the InChIKey of [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate?
The InChIKey is XKLHYWFVMNOSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O9S3/c1-19(10,11)16-7-4-5-8(17-20(2,12)13)9(6-7)18-21(3,14)15/h4-6H,1-3H3.
What are the key properties of [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate?
[3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate has a molecular weight of 360.39 g/mol, XLogP of -0.30, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-bis(methylsulfonyloxy)phenyl] methanesulfonate is sourced from PubChem (CID 10109152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).